Products 62023-62-5

CAS 62023-62-5 appears in our catalog under these names: (2S,3S)-3-Amino-2-hydroxy-4-phenylbutanoic acid, 95%, (2S,3S)-3-Amino-2-hydroxy-4-phenylbutyric acid hydrochloride, 95%, (2S,3S)-3-Amino-2-hydroxy-4-phenylbutanoic acid, 95+%, Allophenylnorstatine. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 1g, 100mg, 250mg.

Structural formula: {0} (CAS {1})

(2S,3S)-3-amino-2-hydroxy-4-phenylbutanoic acid (CAS 62023-62-5) is a chemical compound with the molecular formula C10H13NO3 and a molecular weight of 195.21 g/mol. IUPAC name: (2S,3S)-3-amino-2-hydroxy-4-phenylbutanoic acid. InChIKey: LDSJMFGYNFIFRK-IUCAKERBSA-N.

Identity
Molecular formulaC10H13NO3
Molecular weight195.21 g/mol
IUPAC name(2S,3S)-3-amino-2-hydroxy-4-phenylbutanoic acid
InChIKeyLDSJMFGYNFIFRK-IUCAKERBSA-N
SMILESC1=CC=C(C=C1)C[C@@H]([C@@H](C(=O)O)O)N

Computed by PubChem (NCBI)