CAS 62084-21-3 is the registry number for Allophenylnorstatine. Offered by: Creative Peptides. Available pack sizes: 250mg, 1g.
(2S,3R)-3-amino-2-hydroxy-4-phenylbutanoic acid (CAS 62084-21-3) is a chemical compound with the molecular formula C10H13NO3 and a molecular weight of 195.21 g/mol. IUPAC name: (2S,3R)-3-amino-2-hydroxy-4-phenylbutanoic acid. InChIKey: LDSJMFGYNFIFRK-BDAKNGLRSA-N.
| Molecular formula | C10H13NO3 |
|---|---|
| Molecular weight | 195.21 g/mol |
| IUPAC name | (2S,3R)-3-amino-2-hydroxy-4-phenylbutanoic acid |
| InChIKey | LDSJMFGYNFIFRK-BDAKNGLRSA-N |
| SMILES | C1=CC=C(C=C1)C[C@H]([C@@H](C(=O)O)O)N |
Computed by PubChem (NCBI)