Products 62034-73-5
CAS 62034-73-5 appears in our catalog under these names: 4–(tert–Butyl)–benzhydroxamic Acid, 4-tert-Butylbenzhydroxamic Acid, 4-(tert-Butyl)-benzhydroxamic Acid, 4-(tert-Butyl)-N-hydroxybenzamide, 95%, 95%, 4-(tert-Butyl)-benzhydroxamic Acid, 99.69%. Offered by: GLPBio, TRC, TargetMol, Chemat, MedChemExpress. Available pack sizes: 5mg, 250mg, 2mg, 10mg, 100mg, 50mg, 1g, 5g.
4-tert-butyl-N-hydroxybenzamide (CAS 62034-73-5) is a chemical compound with the molecular formula C11H15NO2 and a molecular weight of 193.24 g/mol. IUPAC name: 4-tert-butyl-N-hydroxybenzamide. InChIKey: HVTKRCPHQXJOFW-UHFFFAOYSA-N.
| Molecular formula | C11H15NO2 |
|---|---|
| Molecular weight | 193.24 g/mol |
| IUPAC name | 4-tert-butyl-N-hydroxybenzamide |
| InChIKey | HVTKRCPHQXJOFW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)C(=O)NO |
Computed by PubChem (NCBI)