Products 62075-26-7
CAS 62075-26-7 is the registry number for cis-4-Aminoadamantan-1-ol Hydrochloride, >95%, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
(3R,5S)-4-aminoadamantan-1-ol;hydrochloride (CAS 62075-26-7) is a chemical compound with the molecular formula C10H18ClNO and a molecular weight of 203.71 g/mol. IUPAC name: (3R,5S)-4-aminoadamantan-1-ol;hydrochloride. InChIKey: KWEPNQFVPHYHHO-ILQIGJEOSA-N.
| Molecular formula | C10H18ClNO |
|---|---|
| Molecular weight | 203.71 g/mol |
| IUPAC name | (3R,5S)-4-aminoadamantan-1-ol;hydrochloride |
| InChIKey | KWEPNQFVPHYHHO-ILQIGJEOSA-N |
| SMILES | C1[C@@H]2CC3(C[C@@H](C2N)CC1C3)O.Cl |
Computed by PubChem (NCBI)