CAS 621-50-1 appears in our catalog under these names: 3–Nitrophenylacetonitrile, 3-Nitrophenylacetonitrile 98%, 3-NITROPHENYLACETONITRILE, 99%, 3-Nitrophenylacetonitrile, 98%. Offered by: GLPBio, Ambeed, Sigma-Aldrich, Fluorochem. Available pack sizes: 1g, 5g, 25g, 100g, 10g.
2-(3-nitrophenyl)acetonitrile (CAS 621-50-1) is a chemical compound with the molecular formula C8H6N2O2 and a molecular weight of 162.15 g/mol. IUPAC name: 2-(3-nitrophenyl)acetonitrile. InChIKey: WAVKEPUFQMUGBP-UHFFFAOYSA-N.
| Molecular formula | C8H6N2O2 |
|---|---|
| Molecular weight | 162.15 g/mol |
| IUPAC name | 2-(3-nitrophenyl)acetonitrile |
| InChIKey | WAVKEPUFQMUGBP-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)[N+](=O)[O-])CC#N |
Computed by PubChem (NCBI)