Products 62144-92-7
CAS 62144-92-7 is the registry number for 4-(Adamantane-1-amido)benzoic acid. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
4-(adamantane-1-carbonylamino)benzoic acid (CAS 62144-92-7) is a chemical compound with the molecular formula C18H21NO3 and a molecular weight of 299.4 g/mol. IUPAC name: 4-(adamantane-1-carbonylamino)benzoic acid. InChIKey: RXUAHMQUGGEWOB-UHFFFAOYSA-N.
| Molecular formula | C18H21NO3 |
|---|---|
| Molecular weight | 299.4 g/mol |
| IUPAC name | 4-(adamantane-1-carbonylamino)benzoic acid |
| InChIKey | RXUAHMQUGGEWOB-UHFFFAOYSA-N |
| SMILES | C1C2CC3CC1CC(C2)(C3)C(=O)NC4=CC=C(C=C4)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
4-[(1-adamantylcarbonyl)amino]benzoic acid, 4-(Adamantane-1-carboxamido)benzoic acid, 4-(adamantane-1-carbonylamino)benzoic acid, 4-(adamantane-1-amido)benzoic acid, Oprea1_472619, Oprea1_601531, 4-((3r,5r,7r)-adamantane-1-carboxamido)benzoic acid, IFLab1_005125, 4-(Adamantane-1-carboxamido)benzoicacid, 4-(adamantanylcarbonylamino)benzoic acid