CAS 6216-63-3 appears in our catalog under these names: Z–Prolinol, N-Carbobenzoxy-L-prolinol, >98.0%(GC), Cbz-Pro-ol 98%, 1-Pyrrolidinecarboxylic acid, 2-(hydroxymethyl)-, phenylmethyl ester, (2S)-, 98%, 98%, Z-Prolinol, 97%. Offered by: GLPBio, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g, 50g.
Benzyl (2S)-2-(hydroxymethyl)pyrrolidine-1-carboxylate (CAS 6216-63-3) is a chemical compound with the molecular formula C13H17NO3 and a molecular weight of 235.28 g/mol. IUPAC name: benzyl (2S)-2-(hydroxymethyl)pyrrolidine-1-carboxylate. InChIKey: BJTNHGVCFWDNDP-LBPRGKRZSA-N.
| Molecular formula | C13H17NO3 |
|---|---|
| Molecular weight | 235.28 g/mol |
| IUPAC name | benzyl (2S)-2-(hydroxymethyl)pyrrolidine-1-carboxylate |
| InChIKey | BJTNHGVCFWDNDP-LBPRGKRZSA-N |
| SMILES | C1C[C@H](N(C1)C(=O)OCC2=CC=CC=C2)CO |
Computed by PubChem (NCBI)