CAS 62218-55-7 is the registry number for 4-Hydroxy-2,6,6-trimethyl-1-cyclohexenecarboxylic acid. Offered by: Biosynth, MedChemExpress. Available pack sizes: 5mg, 1mg, 10mg, 50mg, 25mg, Get quote.
4-hydroxy-2,6,6-trimethylcyclohexene-1-carboxylic acid (CAS 62218-55-7) is a chemical compound with the molecular formula C10H16O3 and a molecular weight of 184.23 g/mol. IUPAC name: 4-hydroxy-2,6,6-trimethylcyclohexene-1-carboxylic acid. InChIKey: VLNNCUQICIFEOF-UHFFFAOYSA-N.
| Molecular formula | C10H16O3 |
|---|---|
| Molecular weight | 184.23 g/mol |
| IUPAC name | 4-hydroxy-2,6,6-trimethylcyclohexene-1-carboxylic acid |
| InChIKey | VLNNCUQICIFEOF-UHFFFAOYSA-N |
| SMILES | CC1=C(C(CC(C1)O)(C)C)C(=O)O |
Computed by PubChem (NCBI)