CAS 70882-66-5 appears in our catalog under these names: Z–D–Dab–OH, Z-D-Dab-OH, N-Alpha-benzyloxycarbonyl-D-2,4-diaminobutyric acid, 98%, 98%, Cbz-D-2,4-Diaminobutyric acid, 97%, Cbz-D-α-Dab-OH, 98%. Offered by: GLPBio, Iris Biotech, Chemat, Fluorochem, Ambeed. Available pack sizes: 5g, 1g, 25g, 250mg, 10g.
(2R)-4-amino-2-(phenylmethoxycarbonylamino)butanoic acid (CAS 70882-66-5) is a chemical compound with the molecular formula C12H16N2O4 and a molecular weight of 252.27 g/mol. IUPAC name: (2R)-4-amino-2-(phenylmethoxycarbonylamino)butanoic acid. InChIKey: KXMSCBRTBLPGIN-SNVBAGLBSA-N.
| Molecular formula | C12H16N2O4 |
|---|---|
| Molecular weight | 252.27 g/mol |
| IUPAC name | (2R)-4-amino-2-(phenylmethoxycarbonylamino)butanoic acid |
| InChIKey | KXMSCBRTBLPGIN-SNVBAGLBSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)N[C@H](CCN)C(=O)O |
Computed by PubChem (NCBI)