CAS 62284-86-0 is the registry number for 6-(Naphthalen-2-yl)-5,6-dihydroimidazo[2,1-b]thiazole oxalate, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
6-naphthalen-2-yl-5,6-dihydroimidazo[2,1-b][1,3]thiazole;oxalic acid (CAS 62284-86-0) is a chemical compound with the molecular formula C17H14N2O4S and a molecular weight of 342.4 g/mol. IUPAC name: 6-naphthalen-2-yl-5,6-dihydroimidazo[2,1-b][1,3]thiazole;oxalic acid. InChIKey: LVBSSRLESHNUHX-UHFFFAOYSA-N.
| Molecular formula | C17H14N2O4S |
|---|---|
| Molecular weight | 342.4 g/mol |
| IUPAC name | 6-naphthalen-2-yl-5,6-dihydroimidazo[2,1-b][1,3]thiazole;oxalic acid |
| InChIKey | LVBSSRLESHNUHX-UHFFFAOYSA-N |
| SMILES | C1C(N=C2N1C=CS2)C3=CC4=CC=CC=C4C=C3.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)