CAS 931323-51-2 is the registry number for N-1,3-Benzodioxol-5-yl-4-methyl-5-phenyl-3-isothiazolamine 1,1-Dioxide. Offered by: TRC. Available pack sizes: 100mg.
N-(1,3-benzodioxol-5-yl)-4-methyl-1,1-dioxo-5-phenyl-1,2-thiazol-3-amine (CAS 931323-51-2) is a chemical compound with the molecular formula C17H14N2O4S and a molecular weight of 342.4 g/mol. IUPAC name: N-(1,3-benzodioxol-5-yl)-4-methyl-1,1-dioxo-5-phenyl-1,2-thiazol-3-amine. InChIKey: FDQIMQZMOMSFHM-UHFFFAOYSA-N.
| Molecular formula | C17H14N2O4S |
|---|---|
| Molecular weight | 342.4 g/mol |
| IUPAC name | N-(1,3-benzodioxol-5-yl)-4-methyl-1,1-dioxo-5-phenyl-1,2-thiazol-3-amine |
| InChIKey | FDQIMQZMOMSFHM-UHFFFAOYSA-N |
| SMILES | CC1=C(S(=O)(=O)N=C1NC2=CC3=C(C=C2)OCO3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)