Products 887044-72-6
CAS 887044-72-6 is the registry number for 4-((1,1-Dioxidobenzo(d)isothiazol-3-yl)(methyl)amino)phenyl Acrylate. Offered by: TRC. Available pack sizes: 250mg.
[4-[(1,1-dioxo-1,2-benzothiazol-3-yl)-methylamino]phenyl] prop-2-enoate (CAS 887044-72-6) is a chemical compound with the molecular formula C17H14N2O4S and a molecular weight of 342.4 g/mol. IUPAC name: [4-[(1,1-dioxo-1,2-benzothiazol-3-yl)-methylamino]phenyl] prop-2-enoate. InChIKey: ABLGJAOEDALXHK-UHFFFAOYSA-N.
| Molecular formula | C17H14N2O4S |
|---|---|
| Molecular weight | 342.4 g/mol |
| IUPAC name | [4-[(1,1-dioxo-1,2-benzothiazol-3-yl)-methylamino]phenyl] prop-2-enoate |
| InChIKey | ABLGJAOEDALXHK-UHFFFAOYSA-N |
| SMILES | CN(C1=CC=C(C=C1)OC(=O)C=C)C2=NS(=O)(=O)C3=CC=CC=C32 |
Computed by PubChem (NCBI)