CAS 623583-91-5 appears in our catalog under these names: 1-(2-Naphthalenyl)cyclopropanecarboxylic acid, 98%, 1-(2-Naphthalenyl)cyclopropanecarboxylic acid, 98%, 98%, 1-(2-NAPHTHYL)CYCLOPROPANECARBOXYLIC ACID, 98%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 100mg, 250mg, 1g.
1-naphthalen-2-ylcyclopropane-1-carboxylic acid (CAS 623583-91-5) is a chemical compound with the molecular formula C14H12O2 and a molecular weight of 212.24 g/mol. IUPAC name: 1-naphthalen-2-ylcyclopropane-1-carboxylic acid. InChIKey: MBNILIMKOCLKMN-UHFFFAOYSA-N.
| Molecular formula | C14H12O2 |
|---|---|
| Molecular weight | 212.24 g/mol |
| IUPAC name | 1-naphthalen-2-ylcyclopropane-1-carboxylic acid |
| InChIKey | MBNILIMKOCLKMN-UHFFFAOYSA-N |
| SMILES | C1CC1(C2=CC3=CC=CC=C3C=C2)C(=O)O |
Computed by PubChem (NCBI)