Products 6236-05-1
CAS 6236-05-1 is the registry number for Nifuroxime. Offered by: MedChemExpress. Available pack sizes: Get quote.
(NZ)-N-[(5-nitrofuran-2-yl)methylidene]hydroxylamine (CAS 6236-05-1) is a chemical compound with the molecular formula C5H4N2O4 and a molecular weight of 156.10 g/mol. IUPAC name: (NZ)-N-[(5-nitrofuran-2-yl)methylidene]hydroxylamine. InChIKey: PTBKFATYSVLSSD-UTCJRWHESA-N.
| Molecular formula | C5H4N2O4 |
|---|---|
| Molecular weight | 156.10 g/mol |
| IUPAC name | (NZ)-N-[(5-nitrofuran-2-yl)methylidene]hydroxylamine |
| InChIKey | PTBKFATYSVLSSD-UTCJRWHESA-N |
| SMILES | C1=C(OC(=C1)[N+](=O)[O-])/C=N\O |
Computed by PubChem (NCBI)