CAS 62475-58-5 is the registry number for d-glucoheptose . Offered by: Chemat Brand. Available pack sizes: on request.
(2R,3R,4R,5S,6R)-2,3,4,5,6,7-hexahydroxyheptanal (CAS 62475-58-5) is a chemical compound with the molecular formula C7H14O7 and a molecular weight of 210.18 g/mol. IUPAC name: (2R,3R,4R,5S,6R)-2,3,4,5,6,7-hexahydroxyheptanal. InChIKey: YPZMPEPLWKRVLD-REQIZBSHSA-N.
| Molecular formula | C7H14O7 |
|---|---|
| Molecular weight | 210.18 g/mol |
| IUPAC name | (2R,3R,4R,5S,6R)-2,3,4,5,6,7-hexahydroxyheptanal |
| InChIKey | YPZMPEPLWKRVLD-REQIZBSHSA-N |
| SMILES | C([C@H]([C@@H]([C@H]([C@H]([C@H](C=O)O)O)O)O)O)O |
Computed by PubChem (NCBI)