CAS 7634-39-1 appears in our catalog under these names: (3S,4S,5R,6R)-2,3,4,5,6,7-Hexahydroxyheptanal, 98+%, (2R,3S,4S,5R,6S)–2–(Hydroxymethyl)–6–(isopropylthio)tetrahydro–2H–pyran–3,4,5–triol, D-manno-Heptose, 98.0%. Offered by: Chemat Brand, GLPBio, MedChemExpress. Available pack sizes: on request, 250mg, 500mg, 50 mg, 25 mg, 100 mg.
(3S,4S,5R,6R)-2,3,4,5,6,7-hexahydroxyheptanal (CAS 7634-39-1) is a chemical compound with the molecular formula C7H14O7 and a molecular weight of 210.18 g/mol. IUPAC name: (3S,4S,5R,6R)-2,3,4,5,6,7-hexahydroxyheptanal. InChIKey: YPZMPEPLWKRVLD-VHQZISHXSA-N.
| Molecular formula | C7H14O7 |
|---|---|
| Molecular weight | 210.18 g/mol |
| IUPAC name | (3S,4S,5R,6R)-2,3,4,5,6,7-hexahydroxyheptanal |
| InChIKey | YPZMPEPLWKRVLD-VHQZISHXSA-N |
| SMILES | C([C@H]([C@H]([C@@H]([C@@H](C(C=O)O)O)O)O)O)O |
Computed by PubChem (NCBI)