CAS 87172-53-0 is the registry number for (2R,3R,4S,5R,6S)-6-((R)-1,2-Dihydroxyethyl)tetrahydro-2H-pyran-2,3,4,5-tetraol, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
(3R,4S,5R,6S)-6-[(1R)-1,2-dihydroxyethyl]oxane-2,3,4,5-tetrol (CAS 87172-53-0) is a chemical compound with the molecular formula C7H14O7 and a molecular weight of 210.18 g/mol. IUPAC name: (3R,4S,5R,6S)-6-[(1R)-1,2-dihydroxyethyl]oxane-2,3,4,5-tetrol. InChIKey: BGWQRWREUZVRGI-MKHROBFTSA-N.
| Molecular formula | C7H14O7 |
|---|---|
| Molecular weight | 210.18 g/mol |
| IUPAC name | (3R,4S,5R,6S)-6-[(1R)-1,2-dihydroxyethyl]oxane-2,3,4,5-tetrol |
| InChIKey | BGWQRWREUZVRGI-MKHROBFTSA-N |
| SMILES | C([C@H]([C@H]1[C@@H]([C@@H]([C@H](C(O1)O)O)O)O)O)O |
Computed by PubChem (NCBI)