CAS 62502-71-0 appears in our catalog under these names: Glycerol-d5, >95% (GC), Glycerol D5, Glycerol-1,1,2,3,3-d5, 98 atom % D, min 98% Chemical Purity, glycerol–1,1,2,3,3–D5, Glycerol–d5. Offered by: TRC, Dr. Ehrenstorfer, CDN, GLPBio, Sigma-Aldrich. Available pack sizes: 100mg, 1g, 5g, 25mg, 50mg, 50 mg, 25 mg, 100 mg.
1,1,2,3,3-pentadeuteriopropane-1,2,3-triol (CAS 62502-71-0) is a chemical compound with the molecular formula C3H8O3 and a molecular weight of 97.12 g/mol. IUPAC name: 1,1,2,3,3-pentadeuteriopropane-1,2,3-triol. InChIKey: PEDCQBHIVMGVHV-UXXIZXEISA-N.
| Molecular formula | C3H8O3 |
|---|---|
| Molecular weight | 97.12 g/mol |
| IUPAC name | 1,1,2,3,3-pentadeuteriopropane-1,2,3-triol |
| InChIKey | PEDCQBHIVMGVHV-UXXIZXEISA-N |
| SMILES | [2H]C([2H])(C([2H])(C([2H])([2H])O)O)O |
Computed by PubChem (NCBI)