CAS 63346-81-6 appears in our catalog under these names: Glycerol-13C3, Glycerol-13C3, >95% (GC), Glycerol–13C3, GLYCEROL-13C3, 99 ATOM % 13C, Glycerol-13C3, 99.10%. Offered by: Chemat Brand, TRC, GLPBio, Sigma-Aldrich, Chemat. Available pack sizes: on request, 100mg, 10mg, 500mg, 50mg, 1G, 5G, 100 mg.
(1,2,3-13C3)propane-1,2,3-triol (CAS 63346-81-6) is a chemical compound with the molecular formula C3H8O3 and a molecular weight of 95.072 g/mol. IUPAC name: (1,2,3-13C3)propane-1,2,3-triol. InChIKey: PEDCQBHIVMGVHV-VMIGTVKRSA-N.
| Molecular formula | C3H8O3 |
|---|---|
| Molecular weight | 95.072 g/mol |
| IUPAC name | (1,2,3-13C3)propane-1,2,3-triol |
| InChIKey | PEDCQBHIVMGVHV-VMIGTVKRSA-N |
| SMILES | [13CH2]([13CH]([13CH2]O)O)O |
Computed by PubChem (NCBI)