CAS 7325-17-9 appears in our catalog under these names: Glycerol-d8, Glycerol-d8, 98 atom % D, min 98% Chemical Purity, Glycerol–d8, GLYCEROL-D8, >=98 ATOM % D, >=98% CP, Glycerol-d8, 98.30%. Offered by: TRC, CDN, GLPBio, Sigma-Aldrich, MedChemExpress. Available pack sizes: 100mg, 250mg, 500mg, 5g, 1g, 50 mg, 100 mg.
1,1,2,3,3-pentadeuterio-1,2,3-trideuteriooxypropane (CAS 7325-17-9) is a chemical compound with the molecular formula C3H8O3 and a molecular weight of 100.14 g/mol. IUPAC name: 1,1,2,3,3-pentadeuterio-1,2,3-trideuteriooxypropane. InChIKey: PEDCQBHIVMGVHV-YHPVEMKJSA-N.
| Molecular formula | C3H8O3 |
|---|---|
| Molecular weight | 100.14 g/mol |
| IUPAC name | 1,1,2,3,3-pentadeuterio-1,2,3-trideuteriooxypropane |
| InChIKey | PEDCQBHIVMGVHV-YHPVEMKJSA-N |
| SMILES | [2H]C([2H])(C([2H])(C([2H])([2H])O[2H])O[2H])O[2H] |
Computed by PubChem (NCBI)