Products 625412-88-6
CAS 625412-88-6 is the registry number for 3-(1-(4-hydroxyphenyl)-5-phenyl-1H-pyrrol-2-yl)propanoic acid, ≥98%. Offered by: Chemat. Available pack sizes: 1mg, 5mg, 25mg, 50mg, 100mg.
3-[1-(4-hydroxyphenyl)-5-phenylpyrrol-2-yl]propanoic acid (CAS 625412-88-6) is a chemical compound with the molecular formula C19H17NO3 and a molecular weight of 307.3 g/mol. IUPAC name: 3-[1-(4-hydroxyphenyl)-5-phenylpyrrol-2-yl]propanoic acid. InChIKey: ASVSBHMGHOYCLN-UHFFFAOYSA-N.
| Molecular formula | C19H17NO3 |
|---|---|
| Molecular weight | 307.3 g/mol |
| IUPAC name | 3-[1-(4-hydroxyphenyl)-5-phenylpyrrol-2-yl]propanoic acid |
| InChIKey | ASVSBHMGHOYCLN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(N2C3=CC=C(C=C3)O)CCC(=O)O |
Computed by PubChem (NCBI)