CAS 62564-54-9 appears in our catalog under these names: 3,6-Dimethyl-2-nitrobenzene-1-sulfonyl chloride, 95%, 3,6-Dimethyl-2-nitrobenzene-1-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
3,6-dimethyl-2-nitrobenzenesulfonyl chloride (CAS 62564-54-9) is a chemical compound with the molecular formula C8H8ClNO4S and a molecular weight of 249.67 g/mol. IUPAC name: 3,6-dimethyl-2-nitrobenzenesulfonyl chloride. InChIKey: YLEWUFDGSHJHHL-UHFFFAOYSA-N.
| Molecular formula | C8H8ClNO4S |
|---|---|
| Molecular weight | 249.67 g/mol |
| IUPAC name | 3,6-dimethyl-2-nitrobenzenesulfonyl chloride |
| InChIKey | YLEWUFDGSHJHHL-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1)C)S(=O)(=O)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)