CAS 626248-56-4 appears in our catalog under these names: 3-(2H-1,2,3-Trizazol-2-yl)aniline, 97%, 3-(2H-1,2,3-Trizazol-2-yl)aniline, 3-(2H-1,2,3-Triazol-2-yl)aniline, 96%, 96%, 3-(2H-1,2,3-Trizazol-2-yl)aniline, 96%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 25g, 1g, 2,5g, 250mg, 100mg, 10g.
3-(triazol-2-yl)aniline (CAS 626248-56-4) is a chemical compound with the molecular formula C8H8N4 and a molecular weight of 160.18 g/mol. IUPAC name: 3-(triazol-2-yl)aniline. InChIKey: YKEAQCXIDHBMLM-UHFFFAOYSA-N.
| Molecular formula | C8H8N4 |
|---|---|
| Molecular weight | 160.18 g/mol |
| IUPAC name | 3-(triazol-2-yl)aniline |
| InChIKey | YKEAQCXIDHBMLM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)N2N=CC=N2)N |
Computed by PubChem (NCBI)