CAS 62653-26-3 is the registry number for 2-Amino-3,3-diphenyl-propionic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 10G, 250mg.
2-amino-3,3-diphenylpropanoic acid (CAS 62653-26-3) is a chemical compound with the molecular formula C15H15NO2 and a molecular weight of 241.28 g/mol. IUPAC name: 2-amino-3,3-diphenylpropanoic acid. InChIKey: PECGVEGMRUZOML-UHFFFAOYSA-N.
| Molecular formula | C15H15NO2 |
|---|---|
| Molecular weight | 241.28 g/mol |
| IUPAC name | 2-amino-3,3-diphenylpropanoic acid |
| InChIKey | PECGVEGMRUZOML-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)C(C(=O)O)N |
Computed by PubChem (NCBI)