Products 6266-66-6
CAS 6266-66-6 appears in our catalog under these names: 2-Indol-3-yl-4-oxo-4-phenylbutanoic Acid, PEO-IAA/ 98.67% (existing batch purity), PEO–IAA (2–(1H–Indol–3–yl)–4–oxo–4–phenyl–butyric acid), 2-(1H-Indol-3-yl)-4-oxo-4-phenylbutanoic acid, 99.61% ,, 99.61% ,, PEO-IAA, 99.70%. Offered by: TRC, TargetMol, GLPBio, Biosynth, Chemat. Available pack sizes: 2,5g, 25mg, 50mg, 10mg, 100mg, 5mg, 10mM (in 1ml dmso), 1000mg.
2-(1H-indol-3-yl)-4-oxo-4-phenylbutanoic acid (CAS 6266-66-6) is a chemical compound with the molecular formula C18H15NO3 and a molecular weight of 293.3 g/mol. IUPAC name: 2-(1H-indol-3-yl)-4-oxo-4-phenylbutanoic acid. InChIKey: SJVMWLJNHPHNPT-UHFFFAOYSA-N.
| Molecular formula | C18H15NO3 |
|---|---|
| Molecular weight | 293.3 g/mol |
| IUPAC name | 2-(1H-indol-3-yl)-4-oxo-4-phenylbutanoic acid |
| InChIKey | SJVMWLJNHPHNPT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)CC(C2=CNC3=CC=CC=C32)C(=O)O |
Computed by PubChem (NCBI)