CAS 62668-02-4 appears in our catalog under these names: trans–1,3–Diphenyl–2–propen–1–ol, trans-1,3-Diphenyl-2-propen-1-ol, >97.0%(GC), trans-1,3-Diphenyl-2-propen-1-ol, (E)-1,3-Diphenylprop-2-en-1-ol 95%, TRANS-1,3-DIPHENYL-2-PROPEN-1-OL, >=98&. Offered by: GLPBio, TCI, Chemat, Ambeed, Sigma-Aldrich. Available pack sizes: 25g, 5g, 100g, 1g.
(E)-1,3-diphenylprop-2-en-1-ol (CAS 62668-02-4) is a chemical compound with the molecular formula C15H14O and a molecular weight of 210.27 g/mol. IUPAC name: (E)-1,3-diphenylprop-2-en-1-ol. InChIKey: ORACYDGVNJGDMI-VAWYXSNFSA-N.
| Molecular formula | C15H14O |
|---|---|
| Molecular weight | 210.27 g/mol |
| IUPAC name | (E)-1,3-diphenylprop-2-en-1-ol |
| InChIKey | ORACYDGVNJGDMI-VAWYXSNFSA-N |
| SMILES | C1=CC=C(C=C1)/C=C/C(C2=CC=CC=C2)O |
Computed by PubChem (NCBI)