CAS 6270-17-3 appears in our catalog under these names: Ethyl 4-oxo-4-phenylbutyrate, 95%, Ethyl 4-oxo-4-phenylbutyrate, Ethyl 4-oxo-4-phenylbutanoate, 98%, 98%, Ethyl 4-oxo-4-phenylbutyrate, 98%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem. Available pack sizes: 10g, 1g, 5g, 250mg, 0,5g, 25g, 100mg.
Ethyl 4-oxo-4-phenylbutanoate (CAS 6270-17-3) is a chemical compound with the molecular formula C12H14O3 and a molecular weight of 206.24 g/mol. IUPAC name: ethyl 4-oxo-4-phenylbutanoate. InChIKey: BRUOEHVDTAORQY-UHFFFAOYSA-N.
| Molecular formula | C12H14O3 |
|---|---|
| Molecular weight | 206.24 g/mol |
| IUPAC name | ethyl 4-oxo-4-phenylbutanoate |
| InChIKey | BRUOEHVDTAORQY-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CCC(=O)C1=CC=CC=C1 |
Computed by PubChem (NCBI)