CAS 627463-23-4 is the registry number for 2-Bromo-3'-cyclopropylacetophenone, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-bromo-1-(3-cyclopropylphenyl)ethanone (CAS 627463-23-4) is a chemical compound with the molecular formula C11H11BrO and a molecular weight of 239.11 g/mol. IUPAC name: 2-bromo-1-(3-cyclopropylphenyl)ethanone. InChIKey: AMCOONRENOMFCT-UHFFFAOYSA-N.
| Molecular formula | C11H11BrO |
|---|---|
| Molecular weight | 239.11 g/mol |
| IUPAC name | 2-bromo-1-(3-cyclopropylphenyl)ethanone |
| InChIKey | AMCOONRENOMFCT-UHFFFAOYSA-N |
| SMILES | C1CC1C2=CC(=CC=C2)C(=O)CBr |
Computed by PubChem (NCBI)