Products 627843-18-9
CAS 627843-18-9 is the registry number for 5-(Pyrrolidine-1-sulfonyl)-1,2-dihydropyridin-2-one. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
5-pyrrolidin-1-ylsulfonyl-1H-pyridin-2-one (CAS 627843-18-9) is a chemical compound with the molecular formula C9H12N2O3S and a molecular weight of 228.27 g/mol. IUPAC name: 5-pyrrolidin-1-ylsulfonyl-1H-pyridin-2-one. InChIKey: QOYWWWXFIYKITJ-UHFFFAOYSA-N.
| Molecular formula | C9H12N2O3S |
|---|---|
| Molecular weight | 228.27 g/mol |
| IUPAC name | 5-pyrrolidin-1-ylsulfonyl-1H-pyridin-2-one |
| InChIKey | QOYWWWXFIYKITJ-UHFFFAOYSA-N |
| SMILES | C1CCN(C1)S(=O)(=O)C2=CNC(=O)C=C2 |
Computed by PubChem (NCBI)