Products 62893-37-2
CAS 62893-37-2 appears in our catalog under these names: 2-(4-Azidophenyl)acetic acid, 95+%, 2-(4-azidophenyl)acetic acid, 95%, N3-PhAc-OH, (4-Azidophenyl)acetic acid, N3-PhAc-OH 95+%. Offered by: BLDpharm, Fluorochem, Iris Biotech, Biosynth, MedChemExpress. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g, 500mg, 0,5g, Get quote.
2-(4-azidophenyl)acetic acid (CAS 62893-37-2) is a chemical compound with the molecular formula C8H7N3O2 and a molecular weight of 177.16 g/mol. IUPAC name: 2-(4-azidophenyl)acetic acid. InChIKey: QQKGBHZEZFKXGO-UHFFFAOYSA-N.
| Molecular formula | C8H7N3O2 |
|---|---|
| Molecular weight | 177.16 g/mol |
| IUPAC name | 2-(4-azidophenyl)acetic acid |
| InChIKey | QQKGBHZEZFKXGO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CC(=O)O)N=[N+]=[N-] |
Computed by PubChem (NCBI)