CAS 6294-52-6 appears in our catalog under these names: 5,6-Dimethoxy-1,3-benzothiazol-2-amine, 98%, 5,6–Dimethoxybenzo(d)thiazol–2–amine, 5,6-Dimethoxybenzo[d]thiazol-2-amine 98%, 5,6-Dimethoxybenzo[d]thiazol-2-amine, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Fluorochem. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.
5,6-dimethoxy-1,3-benzothiazol-2-amine (CAS 6294-52-6) is a chemical compound with the molecular formula C9H10N2O2S and a molecular weight of 210.26 g/mol. IUPAC name: 5,6-dimethoxy-1,3-benzothiazol-2-amine. InChIKey: KJRDZJGBIBLGKB-UHFFFAOYSA-N.
| Molecular formula | C9H10N2O2S |
|---|---|
| Molecular weight | 210.26 g/mol |
| IUPAC name | 5,6-dimethoxy-1,3-benzothiazol-2-amine |
| InChIKey | KJRDZJGBIBLGKB-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)N=C(S2)N)OC |
Computed by PubChem (NCBI)