Products 6294-84-4

CAS 6294-84-4 is the registry number for 2-carbamoylcyclohexane-1-carboxylic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

2-carbamoylcyclohexane-1-carboxylic acid (CAS 6294-84-4) is a chemical compound with the molecular formula C8H13NO3 and a molecular weight of 171.19 g/mol. IUPAC name: 2-carbamoylcyclohexane-1-carboxylic acid. InChIKey: LNNRRNLGMOUZCT-UHFFFAOYSA-N.

Identity
Molecular formulaC8H13NO3
Molecular weight171.19 g/mol
IUPAC name2-carbamoylcyclohexane-1-carboxylic acid
InChIKeyLNNRRNLGMOUZCT-UHFFFAOYSA-N
SMILESC1CCC(C(C1)C(=O)N)C(=O)O

Computed by PubChem (NCBI)