CAS 92116-89-7 appears in our catalog under these names: Mitiglinide Impurity 17 (cis), rel-(1R,2S)-2-(Aminocarbonyl)cyclohexanecarboxylic acid, 95%, 95%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 1g.
Cis-(1S,2R)-2-carbamoylcyclohexane-1-carboxylic acid (CAS 92116-89-7) is a chemical compound with the molecular formula C8H13NO3 and a molecular weight of 171.19 g/mol. IUPAC name: cis-(1S,2R)-2-carbamoylcyclohexane-1-carboxylic acid. InChIKey: LNNRRNLGMOUZCT-RITPCOANSA-N.
| Molecular formula | C8H13NO3 |
|---|---|
| Molecular weight | 171.19 g/mol |
| IUPAC name | cis-(1S,2R)-2-carbamoylcyclohexane-1-carboxylic acid |
| InChIKey | LNNRRNLGMOUZCT-RITPCOANSA-N |
| SMILES | C1CC[C@@H]([C@@H](C1)C(=O)N)C(=O)O |
Computed by PubChem (NCBI)