CAS 92116-90-0 appears in our catalog under these names: trans–2–Carbamoylcyclohexanecarboxylic acid, trans-2-Carbamoylcyclohexanecarboxylic acid, 95%, 95%. Offered by: GLPBio, Chemat. Available pack sizes: 100mg, 1g.
Trans-(1R,2R)-2-carbamoylcyclohexane-1-carboxylic acid (CAS 92116-90-0) is a chemical compound with the molecular formula C8H13NO3 and a molecular weight of 171.19 g/mol. IUPAC name: trans-(1R,2R)-2-carbamoylcyclohexane-1-carboxylic acid. InChIKey: LNNRRNLGMOUZCT-PHDIDXHHSA-N.
| Molecular formula | C8H13NO3 |
|---|---|
| Molecular weight | 171.19 g/mol |
| IUPAC name | trans-(1R,2R)-2-carbamoylcyclohexane-1-carboxylic acid |
| InChIKey | LNNRRNLGMOUZCT-PHDIDXHHSA-N |
| SMILES | C1CC[C@H]([C@@H](C1)C(=O)N)C(=O)O |
Computed by PubChem (NCBI)