CAS 63-02-5 is the registry number for 16alpha-Hydroxyandrostenedione. Offered by: TRC. Available pack sizes: 250mg.
16alpha-hydroxyandrost-4-ene-3,17-dione is a 16alpha-hydroxy steroid, a 17-oxo steroid, a secondary alpha-hydroxy ketone, a 3-oxo steroid and an androstanoid. It has a role as a mouse metabolite.
Source: ChEBI
| Molecular formula | C19H26O3 |
|---|---|
| Molecular weight | 302.4 g/mol |
| IUPAC name | (8R,9S,10R,13S,14S,16R)-16-hydroxy-10,13-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,17-dione |
| InChIKey | SSBCZTXGVMMZOT-NBBHSKLNSA-N |
| SMILES | C[C@]12CCC(=O)C=C1CC[C@@H]3[C@@H]2CC[C@]4([C@H]3C[C@H](C4=O)O)C |
Computed by PubChem (NCBI)