CAS 63002-70-0 is the registry number for 3-Amino-2-(4-chlorophenyl)quinazolin-4(3H)-one. Offered by: Biosynth. Available pack sizes: 10000mg, 5000mg.
3-amino-2-(4-chlorophenyl)quinazolin-4-one (CAS 63002-70-0) is a chemical compound with the molecular formula C14H10ClN3O and a molecular weight of 271.70 g/mol. IUPAC name: 3-amino-2-(4-chlorophenyl)quinazolin-4-one. InChIKey: IFVAHOZNQQBOLA-UHFFFAOYSA-N.
| Molecular formula | C14H10ClN3O |
|---|---|
| Molecular weight | 271.70 g/mol |
| IUPAC name | 3-amino-2-(4-chlorophenyl)quinazolin-4-one |
| InChIKey | IFVAHOZNQQBOLA-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C(=N2)C3=CC=C(C=C3)Cl)N |
Computed by PubChem (NCBI)