CAS 63019-97-6 appears in our catalog under these names: 3-Methyl-4-phenylaniline, 95%, 3-Methyl-4-phenylaniline, 3-Methyl-4-phenylaniline, 95%, 95%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat. Available pack sizes: 1g, 5g, 2,5g, 250mg, 100mg.
3-methyl-4-phenylaniline (CAS 63019-97-6) is a chemical compound with the molecular formula C13H13N and a molecular weight of 183.25 g/mol. IUPAC name: 3-methyl-4-phenylaniline. InChIKey: MHXYCLFSHMBXSD-UHFFFAOYSA-N.
| Molecular formula | C13H13N |
|---|---|
| Molecular weight | 183.25 g/mol |
| IUPAC name | 3-methyl-4-phenylaniline |
| InChIKey | MHXYCLFSHMBXSD-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)N)C2=CC=CC=C2 |
Computed by PubChem (NCBI)