CAS 63019-98-7 appears in our catalog under these names: 4-Amino-3-methylbiphenyl, 3-Methyl-[1,1'-biphenyl]-4-amine, 95%, 95%. Offered by: TRC, Chemat. Available pack sizes: 100mg, 1g, 250mg.
2-methyl-4-phenylaniline (CAS 63019-98-7) is a chemical compound with the molecular formula C13H13N and a molecular weight of 183.25 g/mol. IUPAC name: 2-methyl-4-phenylaniline. InChIKey: WAFBISYQIGCOQU-UHFFFAOYSA-N.
| Molecular formula | C13H13N |
|---|---|
| Molecular weight | 183.25 g/mol |
| IUPAC name | 2-methyl-4-phenylaniline |
| InChIKey | WAFBISYQIGCOQU-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)C2=CC=CC=C2)N |
Computed by PubChem (NCBI)