CAS 63024-77-1 appears in our catalog under these names: 3-(Chloromethyl)benzoyl Chloride, 3–(Chloromethyl)–benzoyl chloride, 3-(Chloromethyl)benzoyl Chloride, >93.0%(GC), 3-(Chloromethyl)benzoyl chloride, 98%, 3-(Chloromethyl)benzoyl chloride 95%. Offered by: TRC, GLPBio, TCI, Thermo Scientific (Acros), Ambeed. Available pack sizes: 2,5g, 250mg, 500mg, 100g, 25g, 5g, 1g.
3-(chloromethyl)benzoyl chloride (CAS 63024-77-1) is a chemical compound with the molecular formula C8H6Cl2O and a molecular weight of 189.04 g/mol. IUPAC name: 3-(chloromethyl)benzoyl chloride. InChIKey: YCAIYRWHKSJKEB-UHFFFAOYSA-N.
| Molecular formula | C8H6Cl2O |
|---|---|
| Molecular weight | 189.04 g/mol |
| IUPAC name | 3-(chloromethyl)benzoyl chloride |
| InChIKey | YCAIYRWHKSJKEB-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(=O)Cl)CCl |
Computed by PubChem (NCBI)