Products 6306-25-8
CAS 6306-25-8 appears in our catalog under these names: 4-[(Aminocarbonyl)amino]benzoic acid, 96%, Nafamostat Impurity 7, 4-((Aminocarbonyl)amino)benzoic acid, 4-[(Aminocarbonyl)amino]benzoic acid 96%, 4-[(Aminocarbonyl)amino]benzoic acid, 96%, 96%. Offered by: Combi-blocks, Chemat Brand, Biosynth, Ambeed, Chemat. Available pack sizes: 250mg, 1g, on request, 5g, 0,5g, 100mg.
4-(carbamoylamino)benzoic acid (CAS 6306-25-8) is a chemical compound with the molecular formula C8H8N2O3 and a molecular weight of 180.16 g/mol. IUPAC name: 4-(carbamoylamino)benzoic acid. InChIKey: HOVRQUHNZHBKKJ-UHFFFAOYSA-N.
| Molecular formula | C8H8N2O3 |
|---|---|
| Molecular weight | 180.16 g/mol |
| IUPAC name | 4-(carbamoylamino)benzoic acid |
| InChIKey | HOVRQUHNZHBKKJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)O)NC(=O)N |
Computed by PubChem (NCBI)