CAS 63119-27-7 appears in our catalog under these names: Anitrazafen, Anitrazafen (LY 122512). Offered by: Chemat Brand, GLPBio, Biosynth, MedChemExpress. Available pack sizes: on request, 10mg, 25mg, 5mg, 50mg, 100mg, Get quote.
5,6-bis(4-methoxyphenyl)-3-methyl-1,2,4-triazine (CAS 63119-27-7) is a chemical compound with the molecular formula C18H17N3O2 and a molecular weight of 307.3 g/mol. IUPAC name: 5,6-bis(4-methoxyphenyl)-3-methyl-1,2,4-triazine. InChIKey: HDNJXZZJFPCFHG-UHFFFAOYSA-N.
| Molecular formula | C18H17N3O2 |
|---|---|
| Molecular weight | 307.3 g/mol |
| IUPAC name | 5,6-bis(4-methoxyphenyl)-3-methyl-1,2,4-triazine |
| InChIKey | HDNJXZZJFPCFHG-UHFFFAOYSA-N |
| SMILES | CC1=NC(=C(N=N1)C2=CC=C(C=C2)OC)C3=CC=C(C=C3)OC |
Computed by PubChem (NCBI)