Products 631897-75-1
CAS 631897-75-1 is the registry number for MAT2A-IN-12. Offered by: MedChemExpress. Available pack sizes: Get quote.
8-methoxy-3-methyl-1-(4-methylphenyl)-2-oxido-[1]benzofuro[3,2-c]pyridin-2-ium (CAS 631897-75-1) is a chemical compound with the molecular formula C20H17NO3 and a molecular weight of 319.4 g/mol. IUPAC name: 8-methoxy-3-methyl-1-(4-methylphenyl)-2-oxido-[1]benzofuro[3,2-c]pyridin-2-ium. InChIKey: BWMRZPZVODSGTH-UHFFFAOYSA-N.
| Molecular formula | C20H17NO3 |
|---|---|
| Molecular weight | 319.4 g/mol |
| IUPAC name | 8-methoxy-3-methyl-1-(4-methylphenyl)-2-oxido-[1]benzofuro[3,2-c]pyridin-2-ium |
| InChIKey | BWMRZPZVODSGTH-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=[N+](C(=CC3=C2C4=C(O3)C=CC(=C4)OC)C)[O-] |
Computed by PubChem (NCBI)