CAS 6332-96-3 appears in our catalog under these names: 2-Bromo-4-(tert-butyl)benzoic acid, 98%, 2–Bromo–4–(tert–butyl)benzoic acid, 2-bromo-4-(tert-butyl)benzoic acid, 98%, 98%, 2-Bromo-4-(tert-butyl)benzoic acid, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 100mg, 10g, 25g.
2-bromo-4-tert-butylbenzoic acid (CAS 6332-96-3) is a chemical compound with the molecular formula C11H13BrO2 and a molecular weight of 257.12 g/mol. IUPAC name: 2-bromo-4-tert-butylbenzoic acid. InChIKey: ZLTIYXKXOZKGDG-UHFFFAOYSA-N.
| Molecular formula | C11H13BrO2 |
|---|---|
| Molecular weight | 257.12 g/mol |
| IUPAC name | 2-bromo-4-tert-butylbenzoic acid |
| InChIKey | ZLTIYXKXOZKGDG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=C(C=C1)C(=O)O)Br |
Computed by PubChem (NCBI)