CAS 63328-13-2 is the registry number for (R)-2-Benzylpyrrolidine, 97%. Offered by: AmBeed. Available pack sizes: 5g.
(2R)-2-benzylpyrrolidine (CAS 63328-13-2) is a chemical compound with the molecular formula C11H15N and a molecular weight of 161.24 g/mol. IUPAC name: (2R)-2-benzylpyrrolidine. InChIKey: NKHMSOXIXROFRU-LLVKDONJSA-N.
| Molecular formula | C11H15N |
|---|---|
| Molecular weight | 161.24 g/mol |
| IUPAC name | (2R)-2-benzylpyrrolidine |
| InChIKey | NKHMSOXIXROFRU-LLVKDONJSA-N |
| SMILES | C1C[C@@H](NC1)CC2=CC=CC=C2 |
Computed by PubChem (NCBI)