CAS 97522-31-1 appears in our catalog under these names: (S)-2-Benzylpyrrolidine, 98%, (S)-2-Benzylpyrrolidine. Offered by: AmBeed, MedChemExpress. Available pack sizes: 250mg, 100mg, 1g, Get quote.
(2S)-2-benzylpyrrolidine (CAS 97522-31-1) is a chemical compound with the molecular formula C11H15N and a molecular weight of 161.24 g/mol. IUPAC name: (2S)-2-benzylpyrrolidine. InChIKey: NKHMSOXIXROFRU-NSHDSACASA-N.
| Molecular formula | C11H15N |
|---|---|
| Molecular weight | 161.24 g/mol |
| IUPAC name | (2S)-2-benzylpyrrolidine |
| InChIKey | NKHMSOXIXROFRU-NSHDSACASA-N |
| SMILES | C1C[C@H](NC1)CC2=CC=CC=C2 |
Computed by PubChem (NCBI)