CAS 633318-46-4 appears in our catalog under these names: 3,5-Dibromo-4-chloro-2,6-dimethylpyridine, 98%, 3,5-Dibromo-4-chloro-2,6-dimethylpyridine, 98%, 98%. Offered by: AmBeed, Fluorochem, Chemat. Available pack sizes: 10g, 100mg, 250mg.
3,5-dibromo-4-chloro-2,6-dimethylpyridine (CAS 633318-46-4) is a chemical compound with the molecular formula C7H6Br2ClN and a molecular weight of 299.39 g/mol. IUPAC name: 3,5-dibromo-4-chloro-2,6-dimethylpyridine. InChIKey: SFOGWSXQURLBNE-UHFFFAOYSA-N.
| Molecular formula | C7H6Br2ClN |
|---|---|
| Molecular weight | 299.39 g/mol |
| IUPAC name | 3,5-dibromo-4-chloro-2,6-dimethylpyridine |
| InChIKey | SFOGWSXQURLBNE-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C(=N1)C)Br)Cl)Br |
Computed by PubChem (NCBI)