CAS 861559-78-6 appears in our catalog under these names: 4-Chloro-2,6-dibromo-3-methylaniline, 95+%, 4-Chloro-2,6-dibromo-3-methylaniline, 97%. Offered by: AmBeed, Fluorochem. Available pack sizes: 25g, 1g, 5g.
2,6-dibromo-4-chloro-3-methylaniline (CAS 861559-78-6) is a chemical compound with the molecular formula C7H6Br2ClN and a molecular weight of 299.39 g/mol. IUPAC name: 2,6-dibromo-4-chloro-3-methylaniline. InChIKey: FHNWENFJPJPLCD-UHFFFAOYSA-N.
| Molecular formula | C7H6Br2ClN |
|---|---|
| Molecular weight | 299.39 g/mol |
| IUPAC name | 2,6-dibromo-4-chloro-3-methylaniline |
| InChIKey | FHNWENFJPJPLCD-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1Cl)Br)N)Br |
Computed by PubChem (NCBI)