CAS 915946-47-3 is the registry number for 3,5-Dibromo-2-chloro-4,6-dimethylpyridine, 95+%. Offered by: AmBeed. Available pack sizes: 1g, 5g.
3,5-dibromo-2-chloro-4,6-dimethylpyridine (CAS 915946-47-3) is a chemical compound with the molecular formula C7H6Br2ClN and a molecular weight of 299.39 g/mol. IUPAC name: 3,5-dibromo-2-chloro-4,6-dimethylpyridine. InChIKey: BKMOCGVAJFPIFY-UHFFFAOYSA-N.
| Molecular formula | C7H6Br2ClN |
|---|---|
| Molecular weight | 299.39 g/mol |
| IUPAC name | 3,5-dibromo-2-chloro-4,6-dimethylpyridine |
| InChIKey | BKMOCGVAJFPIFY-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NC(=C1Br)Cl)C)Br |
Computed by PubChem (NCBI)