CAS 634155-02-5 is the registry number for 2-(4-fluoro-3-methylphenyl)-6,6-dimethyl-5,6,7-trihydroindol-4-one. Offered by: Biosynth. Available pack sizes: 250mg.
2-(4-fluoro-3-methylphenyl)-6,6-dimethyl-5,7-dihydro-1H-indol-4-one (CAS 634155-02-5) is a chemical compound with the molecular formula C17H18FNO and a molecular weight of 271.33 g/mol. IUPAC name: 2-(4-fluoro-3-methylphenyl)-6,6-dimethyl-5,7-dihydro-1H-indol-4-one. InChIKey: KVSKGDMXUBIYHY-UHFFFAOYSA-N.
| Molecular formula | C17H18FNO |
|---|---|
| Molecular weight | 271.33 g/mol |
| IUPAC name | 2-(4-fluoro-3-methylphenyl)-6,6-dimethyl-5,7-dihydro-1H-indol-4-one |
| InChIKey | KVSKGDMXUBIYHY-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)C2=CC3=C(N2)CC(CC3=O)(C)C)F |
Computed by PubChem (NCBI)