CAS 93957-51-8 is the registry number for 1-(4-fluorophenyl)-2-(isopropyl(phenyl)amino)ethan-1-one. Offered by: Chemat Brand. Available pack sizes: on request.
1-(4-fluorophenyl)-2-(N-propan-2-ylanilino)ethanone (CAS 93957-51-8) is a chemical compound with the molecular formula C17H18FNO and a molecular weight of 271.33 g/mol. IUPAC name: 1-(4-fluorophenyl)-2-(N-propan-2-ylanilino)ethanone. InChIKey: ZGLVBYZCXLSAPH-UHFFFAOYSA-N.
| Molecular formula | C17H18FNO |
|---|---|
| Molecular weight | 271.33 g/mol |
| IUPAC name | 1-(4-fluorophenyl)-2-(N-propan-2-ylanilino)ethanone |
| InChIKey | ZGLVBYZCXLSAPH-UHFFFAOYSA-N |
| SMILES | CC(C)N(CC(=O)C1=CC=C(C=C1)F)C2=CC=CC=C2 |
Computed by PubChem (NCBI)